CAS 732248-80-5

2-(2-chloroprop-2-enyl)benzoic acid

Description:

2-(2-Chloroprop-2-enyl)benzoic acid, identified by its CAS number 732248-80-5, is an organic compound characterized by the presence of both a benzoic acid moiety and a chloropropenyl group. This compound features a benzene ring attached to a carboxylic acid group (-COOH) and a vinyl group with a chlorine substituent, which contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom enhances the electrophilic character of the vinyl group, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and polymerizations. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical applications. Overall, 2-(2-chloroprop-2-enyl)benzoic acid is a versatile compound with potential utility in both synthetic chemistry and medicinal chemistry.

Formula: C₁₀H₉ClO₂

InChI: InChI=1/C10H9ClO2/c1-7(11)6-8-4-2-3-5-9(8)10(12)13/h2-5H,1,6H2,(H,12,13)

SMILES: C=C(Cc1ccccc1C(=O)O)Cl

2-(2-Chloro-2-propenyl)benzoic acid

CAS: 732248-80-5

Formula: C₁₀H₉ClO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 196.6303

Ref: IN-DA00FCNL

2-(2-Chloro-2-propenyl)benzoic acid

CAS: 732248-80-5

2-(2-Chloro-2-propenyl)benzoic acid

Purity: 95%

Molecular weight: 196.63g/mol

Ref: 54-OR1050830

2-(2-chloro-2-propenyl)benzoic acid

CAS: 732248-80-5

Formula: C₁₀H₉ClO₂

Purity: 97.0%

Molecular weight: 196.63

Ref: 10-F200760