CAS 732248-87-2
:2-(3-chlorobut-3-enyl)benzoic acid
Description:
2-(3-Chlorobut-3-enyl)benzoic acid is an organic compound characterized by its benzoic acid structure modified with a 3-chlorobut-3-enyl side chain. This compound features a carboxylic acid functional group (-COOH) attached to a benzene ring, which contributes to its acidity and potential reactivity. The presence of the 3-chlorobut-3-enyl group introduces unsaturation and a chlorine atom, which can influence the compound's chemical behavior, including its reactivity in electrophilic substitution reactions and potential applications in organic synthesis. The chlorinated alkene moiety may also impart unique properties such as increased lipophilicity or altered biological activity. As with many organic compounds, its solubility, stability, and reactivity can be affected by environmental conditions such as pH and temperature. Overall, 2-(3-chlorobut-3-enyl)benzoic acid is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential applications.
Formula:C11H11ClO2
InChI:InChI=1/C11H11ClO2/c1-8(12)6-7-9-4-2-3-5-10(9)11(13)14/h2-5H,1,6-7H2,(H,13,14)
SMILES:C=C(CCc1ccccc1C(=O)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.