CAS 732248-92-9
:2-(2-bromoprop-2-enyl)benzoic acid
Description:
2-(2-Bromoprop-2-enyl)benzoic acid, with the CAS number 732248-92-9, is an organic compound characterized by its unique structure, which includes a benzoic acid moiety and a bromopropenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The benzoic acid part contributes to its acidity and potential for forming salts or esters. The presence of the double bond in the prop-2-enyl group may also allow for additional reactivity, such as polymerization or addition reactions. In terms of solubility, compounds of this nature are often soluble in organic solvents but may have limited solubility in water due to their hydrophobic aromatic components. The compound's specific applications can vary, but it may be of interest in fields such as pharmaceuticals, agrochemicals, or materials science, particularly in the development of new synthetic pathways or functional materials.
Formula:C10H9BrO2
InChI:InChI=1/C10H9BrO2/c1-7(11)6-8-4-2-3-5-9(8)10(12)13/h2-5H,1,6H2,(H,12,13)
SMILES:C=C(Cc1ccccc1C(=O)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.