CymitQuimica logo

CAS 732248-99-6

:

2-(3-bromobut-3-enyl)benzoic acid

Description:
2-(3-Bromobut-3-enyl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety and a 3-bromobut-3-enyl substituent. This compound features a bromine atom attached to a butene chain, which introduces both reactivity and potential for further chemical transformations. The presence of the carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents, while the aromatic benzene ring enhances its stability and can influence its interactions with other molecules. The compound may exhibit interesting biological activities due to the presence of the bromine atom and the unsaturated carbon chain, which can participate in various chemical reactions, such as electrophilic substitutions or additions. Its structural characteristics suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can be hazardous.
Formula:C11H11BrO2
InChI:InChI=1/C11H11BrO2/c1-8(12)6-7-9-4-2-3-5-10(9)11(13)14/h2-5H,1,6-7H2,(H,13,14)
SMILES:C=C(CCc1ccccc1C(=O)O)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.