CymitQuimica logo

CAS 732249-12-6

:

3-(2-chloroprop-2-enyl)benzoic acid

Description:
3-(2-Chloroprop-2-enyl)benzoic acid is an organic compound characterized by its benzoic acid structure modified with a 2-chloroprop-2-enyl group at the meta position. This compound features a carboxylic acid functional group (-COOH), which imparts acidic properties and can participate in various chemical reactions, such as esterification and amidation. The presence of the chloropropenyl substituent introduces both steric and electronic effects, potentially influencing its reactivity and interactions with other molecules. The chlorine atom can enhance the compound's electrophilicity, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its solubility, stability, and reactivity can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, 3-(2-chloroprop-2-enyl)benzoic acid is a versatile compound with potential utility in both synthetic chemistry and medicinal chemistry.
Formula:C10H9ClO2
InChI:InChI=1/C10H9ClO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6H,1,5H2,(H,12,13)
SMILES:C=C(Cc1cccc(c1)C(=O)O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.