CAS 732249-18-2

3-(3-chlorobut-3-enyl)benzoic acid

Description:

3-(3-Chlorobut-3-enyl)benzoic acid is an organic compound characterized by its benzoic acid structure modified with a 3-chlorobut-3-enyl side chain. This compound features a benzene ring attached to a carboxylic acid group (-COOH), which imparts acidic properties. The presence of the 3-chlorobut-3-enyl group introduces unsaturation and a chlorine substituent, which can influence the compound's reactivity and physical properties. Typically, compounds like this may exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the aromatic ring and the aliphatic chain. The chlorine atom can enhance the compound's electrophilicity, making it potentially useful in various chemical reactions, including nucleophilic substitutions. Additionally, the structural features may confer biological activity, making it of interest in medicinal chemistry or agrochemical applications. Overall, the unique combination of functional groups in 3-(3-chlorobut-3-enyl)benzoic acid suggests a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₁H₁₁ClO₂

InChI: InChI=1/C11H11ClO2/c1-8(12)5-6-9-3-2-4-10(7-9)11(13)14/h2-4,7H,1,5-6H2,(H,13,14)

SMILES: C=C(CCc1cccc(c1)C(=O)O)Cl