CAS 732249-24-0
:3-(2-bromoprop-2-enyl)benzoic acid
Description:
3-(2-Bromoprop-2-enyl)benzoic acid is an organic compound characterized by its structure, which features a benzoic acid moiety substituted with a 2-bromoprop-2-enyl group at the meta position. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, while the brominated alkene can engage in various chemical transformations, such as elimination or addition reactions. The presence of the bromine atom also influences the compound's physical properties, such as boiling and melting points, and can affect its biological activity. Overall, 3-(2-bromoprop-2-enyl)benzoic acid is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals, depending on its specific reactivity and biological properties.
Formula:C10H9BrO2
InChI:InChI=1/C10H9BrO2/c1-7(11)5-8-3-2-4-9(6-8)10(12)13/h2-4,6H,1,5H2,(H,12,13)
SMILES:C=C(Cc1cccc(c1)C(=O)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.