CAS 732249-31-9

3-(3-bromobut-3-enyl)benzoic acid

Description:

3-(3-Bromobut-3-enyl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety and a 3-bromobut-3-enyl substituent. This compound features a bromine atom attached to a butenyl group, which introduces both unsaturation and halogen functionality, potentially influencing its reactivity and interactions. The presence of the carboxylic acid group (-COOH) contributes to its acidity and solubility in polar solvents, while the aromatic ring enhances its stability and may provide opportunities for further chemical modifications. The compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the reactivity of the double bond and the electrophilic nature of the bromine atom. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the balance between the hydrophobic aromatic region and the hydrophilic carboxylic acid group. Overall, 3-(3-bromobut-3-enyl)benzoic acid presents a versatile framework for various chemical applications.

Formula: C₁₁H₁₁BrO₂

InChI: InChI=1/C11H11BrO2/c1-8(12)5-6-9-3-2-4-10(7-9)11(13)14/h2-4,7H,1,5-6H2,(H,13,14)

SMILES: C=C(CCc1cccc(c1)C(=O)O)Br