CAS 732249-38-6
:3-(2-methylprop-2-enyl)benzoic acid
Description:
3-(2-Methylprop-2-enyl)benzoic acid, identified by its CAS number 732249-38-6, is an organic compound characterized by its aromatic structure and the presence of a carboxylic acid functional group. This compound features a benzoic acid core, which is substituted at the meta position with a 2-methylprop-2-enyl group, contributing to its unique properties. The presence of the alkenyl side chain enhances its reactivity, making it potentially useful in various chemical reactions, including polymerization and as a building block in organic synthesis. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the aromatic ring and the aliphatic side chain. Its structural characteristics may also impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and van der Waals interactions. Overall, 3-(2-methylprop-2-enyl)benzoic acid is of interest in both academic research and industrial applications, particularly in the fields of materials science and organic chemistry.
Formula:C11H12O2
InChI:InChI=1/C11H12O2/c1-8(2)6-9-4-3-5-10(7-9)11(12)13/h3-5,7H,1,6H2,2H3,(H,12,13)
SMILES:C=C(C)Cc1cccc(c1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.