CAS 732249-50-2

4-(2-chloroprop-2-enyl)benzoic acid

Description:

4-(2-Chloroprop-2-enyl)benzoic acid is an organic compound characterized by its benzoic acid structure modified with a 2-chloroprop-2-enyl group at the para position. This compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties and solubility in polar solvents. The presence of the chloropropenyl substituent introduces both steric and electronic effects, potentially influencing its reactivity and interactions with other molecules. The chlorine atom can enhance the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its unique structure may also impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces like hydrogen bonding and van der Waals interactions. Overall, 4-(2-chloroprop-2-enyl)benzoic acid is a versatile compound with potential applications in multiple fields, including organic synthesis and medicinal chemistry.

Formula: C₁₀H₉ClO₂

InChI: InChI=1/C10H9ClO2/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,1,6H2,(H,12,13)

SMILES: C=C(Cc1ccc(cc1)C(=O)O)Cl

Synonyms:

• 4-(2-CHLORO-ALLYL)-BENZOIC ACID
• Benzoic acid, 4-(2-chloro-2-propen-1-yl)-
• 4-(2-CHLORO-2-PROPENYL)BENZOIC ACID