CAS 732249-57-9

4-(3-chlorobut-3-enyl)benzoic acid

Description:

4-(3-Chlorobut-3-enyl)benzoic acid is an organic compound characterized by its benzoic acid structure, which features a carboxylic acid functional group (-COOH) attached to a benzene ring. The compound also contains a 3-chlorobut-3-enyl substituent, indicating the presence of a chlorinated alkene side chain. This structure contributes to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom can influence the compound's polarity, solubility, and reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid group provides acidic properties, allowing for potential interactions with bases and other nucleophiles. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization.

Formula: C₁₁H₁₁ClO₂

InChI: InChI=1/C11H11ClO2/c1-8(12)2-3-9-4-6-10(7-5-9)11(13)14/h4-7H,1-3H2,(H,13,14)

SMILES: C=C(CCc1ccc(cc1)C(=O)O)Cl