CAS 732249-63-7
:4-(2-bromoprop-2-enyl)benzoic acid
Description:
4-(2-Bromoprop-2-enyl)benzoic acid is an organic compound characterized by its aromatic structure and the presence of both a brominated alkene and a carboxylic acid functional group. The compound features a benzene ring substituted with a 2-bromoprop-2-enyl group, which introduces a degree of unsaturation and reactivity due to the presence of the double bond. The carboxylic acid group (-COOH) contributes to its acidic properties and enhances its solubility in polar solvents. This compound may exhibit interesting chemical reactivity, including potential for electrophilic substitution reactions due to the electron-withdrawing nature of the carboxylic acid and the bromine atom. Additionally, the presence of the bromine atom can influence the compound's physical properties, such as melting point and boiling point, as well as its reactivity in various chemical reactions. Overall, 4-(2-bromoprop-2-enyl)benzoic acid is a versatile compound with potential applications in organic synthesis and materials science.
Formula:C10H9BrO2
InChI:InChI=1/C10H9BrO2/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,1,6H2,(H,12,13)
SMILES:C=C(Cc1ccc(cc1)C(=O)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.