CAS 732249-70-6

4-(3-bromobut-3-enyl)benzoic acid

Description:

4-(3-Bromobut-3-enyl)benzoic acid is an organic compound characterized by its aromatic structure and the presence of both a brominated alkene and a carboxylic acid functional group. The compound features a benzoic acid moiety, which contributes to its acidity and potential for hydrogen bonding. The bromobut-3-enyl group introduces a double bond and a bromine atom, which can influence the compound's reactivity and stability. This structure may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, typical of many aromatic compounds. The presence of the bromine atom can enhance the compound's electrophilic character, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may have applications in organic synthesis, materials science, or as an intermediate in the production of more complex molecules. Its specific reactivity and applications would depend on the context of its use and the presence of other functional groups in a given reaction.

Formula: C₁₁H₁₁BrO₂

InChI: InChI=1/C11H11BrO2/c1-8(12)2-3-9-4-6-10(7-5-9)11(13)14/h4-7H,1-3H2,(H,13,14)

SMILES: C=C(CCc1ccc(cc1)C(=O)O)Br