CAS 732249-74-0
:4-(3-methylbut-3-enyl)benzoic acid
Description:
4-(3-Methylbut-3-enyl)benzoic acid is an organic compound characterized by its aromatic structure, featuring a benzoic acid moiety substituted with a 3-methylbut-3-enyl group at the para position. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic hydrocarbon chain. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in acid-base reactions. Additionally, the compound may exhibit unique reactivity due to the presence of the alkene in the side chain, which can undergo various reactions such as addition or polymerization. Its structural features suggest potential applications in organic synthesis, materials science, or as an intermediate in the production of more complex molecules. As with many organic compounds, safety precautions should be observed when handling, as it may pose health risks or environmental hazards.
Formula:C12H14O2
InChI:InChI=1/C12H14O2/c1-9(2)3-4-10-5-7-11(8-6-10)12(13)14/h5-8H,1,3-4H2,2H3,(H,13,14)
SMILES:C=C(C)CCc1ccc(cc1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.