CAS 732249-79-5
:ethyl 2-(2-ethoxy-2-oxo-acetyl)benzoate
Description:
Ethyl 2-(2-ethoxy-2-oxo-acetyl)benzoate, identified by its CAS number 732249-79-5, is an organic compound that belongs to the class of benzoates. It features an ethyl ester functional group, which contributes to its solubility in organic solvents. The molecule contains a benzoate moiety, indicating that it has aromatic characteristics, which can influence its reactivity and stability. The presence of the ethoxy and keto groups suggests that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may exhibit moderate to low toxicity, typical of many esters, and its physical properties, such as boiling point and melting point, would depend on the specific molecular interactions and structure. Ethyl 2-(2-ethoxy-2-oxo-acetyl)benzoate could have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. As with any chemical substance, proper handling and safety precautions should be observed.
Formula:C13H14O5
InChI:InChI=1/C13H14O5/c1-3-17-12(15)10-8-6-5-7-9(10)11(14)13(16)18-4-2/h5-8H,3-4H2,1-2H3
SMILES:CCOC(=O)c1ccccc1C(=O)C(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.