CAS 732249-84-2

ethyl 3-(2-ethoxy-2-oxo-acetyl)benzoate

Description:

Ethyl 3-(2-ethoxy-2-oxo-acetyl)benzoate, identified by its CAS number 732249-84-2, is an organic compound characterized by its ester functional group, which contributes to its chemical reactivity and solubility properties. This compound features a benzoate moiety, indicating the presence of a benzene ring substituted with an ethyl ester group and a 2-ethoxy-2-oxo-acetyl group. The presence of the ethoxy group enhances its solubility in organic solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The ketone functionality within the 2-oxo-acetyl group may impart reactivity towards nucleophiles, facilitating further chemical transformations. Ethyl 3-(2-ethoxy-2-oxo-acetyl)benzoate may exhibit biological activity, which could be explored in medicinal chemistry. Its structural characteristics suggest potential applications in drug development, particularly in the synthesis of more complex molecules. As with many organic compounds, safety and handling precautions should be observed, given the potential for reactivity and toxicity associated with certain functional groups.

Formula: C₁₃H₁₄O₅

InChI: InChI=1/C13H14O5/c1-3-17-12(15)10-7-5-6-9(8-10)11(14)13(16)18-4-2/h5-8H,3-4H2,1-2H3

SMILES: CCOC(=O)c1cccc(c1)C(=O)C(=O)OCC