CymitQuimica logo

CAS 732251-58-0

:

ethyl oxo(3,4,5-trifluorophenyl)acetate

Description:
Ethyl oxo(3,4,5-trifluorophenyl)acetate is an organic compound characterized by its ester functional group, which is derived from the reaction of ethyl acetate and a trifluorophenyl moiety. The presence of the trifluoromethyl groups on the phenyl ring significantly influences its chemical properties, including increased lipophilicity and potential biological activity. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents. Its molecular structure includes an ethyl group, an oxo group, and a trifluorophenyl group, contributing to its reactivity and potential applications in pharmaceuticals and agrochemicals. The trifluoromethyl substituents can enhance the compound's metabolic stability and alter its interaction with biological targets. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, ethyl oxo(3,4,5-trifluorophenyl)acetate is of interest in synthetic organic chemistry and medicinal chemistry for its unique properties and potential applications.
Formula:C10H7F3O3
InChI:InChI=1/C10H7F3O3/c1-2-16-10(15)9(14)5-3-6(11)8(13)7(12)4-5/h3-4H,2H2,1H3
SMILES:CCOC(=O)C(=O)c1cc(c(c(c1)F)F)F
Synonyms:
  • Benzeneacetic acid, 3,4,5-trifluoro-alpha-oxo-, ethyl ester
  • Ethyl oxo(3,4,5-trifluorophenyl)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.