CymitQuimica logo

CAS 732251-76-2

:

ethyl 2-(5-fluoro-2-methyl-phenyl)-2-oxo-acetate

Description:
Ethyl 2-(5-fluoro-2-methyl-phenyl)-2-oxo-acetate, identified by its CAS number 732251-76-2, is an organic compound characterized by its ester functional group and a substituted aromatic ring. This compound features a fluoro group, which enhances its reactivity and potential biological activity. The presence of the ethyl ester moiety contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The 2-oxo-acetate structure indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions, due to the electrophilic nature of the carbonyl group. Additionally, the specific substitution pattern on the aromatic ring can influence its pharmacological properties, potentially making it a candidate for drug development. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and applications.
Formula:C11H11FO3
InChI:InChI=1/C11H11FO3/c1-3-15-11(14)10(13)9-6-8(12)5-4-7(9)2/h4-6H,3H2,1-2H3
SMILES:CCOC(=O)C(=O)c1cc(ccc1C)F
Synonyms:
  • Benzeneacetic Acid, 5-Fluoro-2-Methyl-Α-Oxo-, Ethyl Ester
  • Ethyl (5-fluoro-2-methylphenyl)(oxo)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.