CAS 732251-89-7
:(1R,3S)-3-benzoylcyclopentane-1-carboxylic acid
Description:
(1R,3S)-3-benzoylcyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 3 positions. The presence of a benzoyl group at the 3-position and a carboxylic acid functional group at the 1-position contributes to its chemical reactivity and potential applications in organic synthesis. This compound exhibits stereochemistry, as indicated by its (1R,3S) configuration, which can influence its biological activity and interactions with other molecules. The carboxylic acid group provides acidic properties, allowing for potential participation in acid-base reactions, while the benzoyl moiety can enhance the compound's lipophilicity and facilitate interactions with biological targets. Its unique structure may also allow for specific conformational arrangements, impacting its solubility and stability in various solvents. Overall, (1R,3S)-3-benzoylcyclopentane-1-carboxylic acid is of interest in medicinal chemistry and materials science due to its distinctive properties and potential utility in drug development and synthesis.
Formula:C13H14O3
InChI:InChI=1/C13H14O3/c14-12(9-4-2-1-3-5-9)10-6-7-11(8-10)13(15)16/h1-5,10-11H,6-8H2,(H,15,16)/t10-,11+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.