CAS 732251-96-6

(1R,3S)-3-(2-methylbenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,3S)-3-(2-methylbenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid group and a 2-methylbenzoyl moiety. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The specific stereochemistry, indicated by the (1R,3S) configuration, suggests that the compound exhibits optical activity, making it relevant in the field of asymmetric synthesis and pharmaceuticals. The 2-methylbenzoyl group contributes to the compound's hydrophobic characteristics, potentially influencing its solubility and reactivity in organic solvents. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry contexts. Overall, this compound's unique structural features and stereochemistry make it a subject of interest for further research in organic synthesis and potential applications in drug development.

Formula: C₁₄H₁₆O₃

InChI: InChI=1/C14H16O3/c1-9-4-2-3-5-12(9)13(15)10-6-7-11(8-10)14(16)17/h2-5,10-11H,6-8H2,1H3,(H,16,17)/t10-,11+/m0/s1