CymitQuimica logo

CAS 732252-10-7

:

(1R,3S)-3-(4-methylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-(4-methylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-10-7, is a chiral compound characterized by its cyclopentane ring structure, which is substituted with a carboxylic acid group and a 4-methylbenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,3S) configuration, which plays a crucial role in its biological activity and interactions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The aromatic 4-methylbenzoyl group contributes to the compound's hydrophobic characteristics and may influence its binding affinity in biological systems. Overall, this compound's unique structural features and stereochemistry make it of interest in fields such as medicinal chemistry and drug design, where the spatial arrangement of atoms can significantly affect pharmacological properties.
Formula:C14H16O3
InChI:InChI=1/C14H16O3/c1-9-2-4-10(5-3-9)13(15)11-6-7-12(8-11)14(16)17/h2-5,11-12H,6-8H2,1H3,(H,16,17)/t11-,12+/m0/s1
Synonyms:
  • Cyclopentanecarboxylic acid, 3-(4-methylbenzoyl)-, (1R,3S)-rel-
  • CIS-3-(4-METHYLBENZOYL)CYCLOPENTANE-1-CARBOXYLIC ACID
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.