CAS 732252-24-3

(1R,3S)-3-(3-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-(3-methoxybenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-24-3, is characterized by its unique structural features and functional groups. This compound contains a cyclopentane ring, which is a five-membered carbon ring, and is substituted with a carboxylic acid group and a 3-methoxybenzoyl moiety. The presence of the carboxylic acid group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The methoxy group on the benzoyl moiety contributes to its hydrophobic character and can influence its solubility in organic solvents. Additionally, the specific stereochemistry denoted by (1R,3S) suggests that the compound has chiral centers, which may affect its biological activity and interactions with other molecules. Overall, this compound may have applications in pharmaceuticals or organic synthesis, depending on its reactivity and biological properties.

Formula: C₁₄H₁₆O₄

InChI: InChI=1/C14H16O4/c1-18-12-4-2-3-9(8-12)13(15)10-5-6-11(7-10)14(16)17/h2-4,8,10-11H,5-7H2,1H3,(H,16,17)/t10-,11+/m0/s1