CAS 732252-30-1

(1R,3S)-3-(4-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,3S)-3-(4-methoxybenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane structure, which features a carboxylic acid functional group and a methoxy-substituted aromatic ring. The presence of the methoxy group on the aromatic ring enhances its lipophilicity and can influence its biological activity. The specific stereochemistry, indicated by the (1R,3S) configuration, suggests that the compound may exhibit unique interactions in biological systems, potentially affecting its pharmacological properties. This compound is likely to be soluble in organic solvents and may exhibit moderate solubility in water due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 732252-30-1, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound make it a subject of interest in various fields, including organic synthesis and drug discovery.

Formula: C₁₄H₁₆O₄

InChI: InChI=1/C14H16O4/c1-18-12-6-4-9(5-7-12)13(15)10-2-3-11(8-10)14(16)17/h4-7,10-11H,2-3,8H2,1H3,(H,16,17)/t10-,11+/m0/s1