CAS 732252-49-2
:(1R,3S)-3-(2-ethylbenzoyl)cyclopentane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-(2-ethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-49-2, is characterized by its unique structural features and stereochemistry. This compound contains a cyclopentane ring, which is a five-membered carbon ring, and is substituted with a carboxylic acid group and a 2-ethylbenzoyl moiety. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The specific stereochemistry, denoted by the (1R,3S) configuration, suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological systems. Additionally, the presence of the ethylbenzoyl group contributes to its hydrophobic characteristics, potentially affecting its solubility and biological activity. Overall, this compound may have applications in pharmaceuticals or organic synthesis, where its unique structure and properties can be leveraged for specific chemical reactions or therapeutic effects.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-2-10-5-3-4-6-13(10)14(16)11-7-8-12(9-11)15(17)18/h3-6,11-12H,2,7-9H2,1H3,(H,17,18)/t11-,12+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.