CymitQuimica logo

CAS 732252-55-0

:

(1R,3S)-3-(4-ethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-(4-ethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-55-0, is characterized by its unique structural features and stereochemistry. It contains a cyclopentane ring, which contributes to its cyclic nature, and a carboxylic acid functional group that imparts acidic properties. The presence of the 4-ethylbenzoyl moiety indicates that it has an aromatic component, which can influence its reactivity and solubility. The specific stereochemistry, denoted by the (1R,3S) configuration, suggests that the molecule has distinct spatial arrangements that can affect its biological activity and interactions with other compounds. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important for its application in various chemical processes or as a potential therapeutic agent. Overall, this compound's unique structure and functional groups contribute to its potential utility in research and industry.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-2-10-3-5-11(6-4-10)14(16)12-7-8-13(9-12)15(17)18/h3-6,12-13H,2,7-9H2,1H3,(H,17,18)/t12-,13+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.