CAS 732252-62-9

(1R,3S)-3-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,3S)-3-(3-chlorobenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 3 positions. The presence of a carboxylic acid functional group at the 1-position contributes to its acidity and potential reactivity, while the 3-(3-chlorobenzoyl) substituent introduces a chlorobenzoyl moiety that can influence the compound's biological activity and solubility. The specific stereochemistry, indicated by the (1R,3S) notation, suggests that the compound exhibits optical activity, which may affect its interactions in biological systems. This compound may be of interest in pharmaceutical research due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular properties, such as solubility, melting point, and stability, would be influenced by the functional groups present and the overall three-dimensional conformation of the molecule. As with many organic compounds, safety and handling considerations are essential, especially given the presence of the chlorine atom, which can impart unique reactivity and toxicity profiles.

Formula: C₁₃H₁₃ClO₃

InChI: InChI=1/C13H13ClO3/c14-11-3-1-2-8(7-11)12(15)9-4-5-10(6-9)13(16)17/h1-3,7,9-10H,4-6H2,(H,16,17)/t9-,10+/m0/s1