CAS 732252-68-5
:(1R,3S)-3-(4-chlorobenzoyl)cyclopentane-1-carboxylic acid
Description:
The chemical substance known as (1R,3S)-3-(4-chlorobenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-68-5, is characterized by its unique structural features and functional groups. It contains a cyclopentane ring, which is a five-membered carbon ring, and is substituted with a carboxylic acid group (-COOH) and a 4-chlorobenzoyl moiety, indicating the presence of a chlorinated aromatic ring attached via a carbonyl linkage. The stereochemistry is specified by the (1R,3S) notation, indicating the specific three-dimensional arrangement of atoms around the chiral centers in the molecule. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. Additionally, the presence of the chlorobenzoyl group may impart specific biological or chemical activities, making it of interest in pharmaceutical or synthetic applications. Overall, its unique structure suggests potential utility in various chemical contexts, including medicinal chemistry and organic synthesis.
Formula:C13H13ClO3
InChI:InChI=1/C13H13ClO3/c14-11-5-3-8(4-6-11)12(15)9-1-2-10(7-9)13(16)17/h3-6,9-10H,1-2,7H2,(H,16,17)/t9-,10+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.