CAS 732252-75-4
:(1R,3S)-3-(3-fluorobenzoyl)cyclopentane-1-carboxylic acid
Description:
(1R,3S)-3-(3-fluorobenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which features a carboxylic acid functional group and a fluorobenzoyl substituent. The presence of the fluorine atom in the benzoyl group can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity and altering its interaction with biological targets. The specific stereochemistry indicated by the (1R,3S) configuration suggests that the compound exhibits optical activity, which may be relevant in pharmacological contexts. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity and the importance of stereochemistry in drug design. Additionally, the carboxylic acid group contributes to its acidity and solubility properties, which can affect its behavior in various chemical environments. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and industry.
Formula:C13H13FO3
InChI:InChI=1/C13H13FO3/c14-11-3-1-2-8(7-11)12(15)9-4-5-10(6-9)13(16)17/h1-3,7,9-10H,4-6H2,(H,16,17)/t9-,10+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.