CAS 732252-83-4

(1R,3S)-3-(4-fluorobenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,3S)-3-(4-fluorobenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 3 positions. The presence of a carboxylic acid functional group at the 1-position contributes to its acidity and potential reactivity, while the 4-fluorobenzoyl group at the 3-position introduces aromatic characteristics and influences the compound's polarity and solubility. The specific stereochemistry, indicated by the (1R,3S) notation, suggests that the compound can exhibit unique biological activity and interactions due to its three-dimensional arrangement. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its properties, such as melting point, solubility, and reactivity, would be influenced by the functional groups present and the overall molecular structure. As with many organic compounds, the stability and behavior of this substance can vary under different conditions, making it essential to consider environmental factors in its application and study.

Formula: C₁₃H₁₃FO₃

InChI: InChI=1/C13H13FO3/c14-11-5-3-8(4-6-11)12(15)9-1-2-10(7-9)13(16)17/h3-6,9-10H,1-2,7H2,(H,16,17)/t9-,10+/m0/s1