CAS 732252-91-4

(1R,3S)-3-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-(2,3-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-91-4, is a chiral compound characterized by its cyclopentane core structure, which is substituted at the 1 and 3 positions. The presence of a carboxylic acid functional group at the 1-position contributes to its acidity and potential reactivity, while the 2,3-dimethylbenzoyl group at the 3-position introduces significant steric and electronic effects, influencing its chemical behavior and interactions. This compound may exhibit specific optical activity due to its chiral centers, making it relevant in fields such as pharmaceuticals, where stereochemistry plays a crucial role in biological activity. Additionally, its structural features suggest potential applications in organic synthesis and material science. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in practical applications.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-9-4-3-5-13(10(9)2)14(16)11-6-7-12(8-11)15(17)18/h3-5,11-12H,6-8H2,1-2H3,(H,17,18)/t11-,12+/m0/s1