CAS 732252-98-1

(1R,3S)-3-(2,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-(2,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732252-98-1, is characterized by its unique structural features and functional groups. This compound contains a cyclopentane ring, which contributes to its cyclic structure, and a carboxylic acid functional group that imparts acidic properties. The presence of a 2,4-dimethylbenzoyl moiety indicates that it has aromatic characteristics, which can influence its reactivity and interactions with other molecules. The specific stereochemistry, denoted by the (1R,3S) configuration, suggests that the compound exhibits chirality, potentially leading to different biological activities or interactions depending on its enantiomeric form. This compound may be of interest in various fields, including pharmaceuticals and organic synthesis, due to its potential applications in drug development or as a building block in complex organic molecules. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent polarity.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-9-3-6-13(10(2)7-9)14(16)11-4-5-12(8-11)15(17)18/h3,6-7,11-12H,4-5,8H2,1-2H3,(H,17,18)/t11-,12+/m0/s1