CymitQuimica logo

CAS 732253-05-3

:

(1R,3S)-3-(2,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-(2,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-05-3, is characterized by its unique structural features and functional groups. It contains a cyclopentane ring, which contributes to its cyclic structure, and a carboxylic acid functional group that imparts acidic properties. The presence of the 2,5-dimethylbenzoyl moiety introduces aromatic characteristics and enhances its potential for various chemical interactions. This compound is likely to exhibit specific stereochemistry due to its chiral centers, which can influence its reactivity and biological activity. The combination of the cyclopentane framework and the aromatic substituent may also affect its solubility, melting point, and overall stability. Such compounds are often of interest in pharmaceutical and materials science due to their potential applications in drug development and as intermediates in organic synthesis. Understanding the properties of this compound can provide insights into its behavior in different chemical environments and its potential uses in various fields.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-3-4-10(2)13(7-9)14(16)11-5-6-12(8-11)15(17)18/h3-4,7,11-12H,5-6,8H2,1-2H3,(H,17,18)/t11-,12+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.