CymitQuimica logo

CAS 732253-13-3

:

(1R,3S)-3-(2,6-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-(2,6-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-13-3, is characterized by its unique structural features that include a cyclopentane ring substituted with a carboxylic acid group and a 2,6-dimethylbenzoyl moiety. This compound exhibits chirality, indicated by its (1R,3S) configuration, which suggests that it has specific optical activity due to the presence of stereocenters. The presence of the carboxylic acid functional group contributes to its acidity and potential reactivity in various chemical reactions, such as esterification or amidation. The dimethylbenzoyl group enhances its hydrophobic characteristics, which may influence its solubility and interaction with biological systems. Overall, this compound may have applications in pharmaceuticals or organic synthesis, where its specific stereochemistry and functional groups can be utilized for targeted chemical reactions or biological activity. Further studies would be necessary to explore its full range of properties and potential applications.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-4-3-5-10(2)13(9)14(16)11-6-7-12(8-11)15(17)18/h3-5,11-12H,6-8H2,1-2H3,(H,17,18)/t11-,12+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.