CymitQuimica logo

CAS 732253-20-2

:

(1R,3S)-3-(3,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,3S)-3-(3,4-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-20-2, is a chiral compound characterized by its cyclopentane core structure. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the 3,4-dimethylbenzoyl moiety indicates that it has significant aromatic characteristics, which can influence its solubility and interaction with other molecules. The specific stereochemistry, denoted by the (1R,3S) configuration, suggests that the compound may exhibit unique biological activity or pharmacological properties due to its three-dimensional arrangement. Such compounds are often of interest in medicinal chemistry and drug development, as their stereochemistry can affect binding affinity and selectivity for biological targets. Overall, this substance's structural features suggest potential applications in pharmaceuticals or as intermediates in organic synthesis.
Formula:C15H18O3
InChI:InChI=1/C15H18O3/c1-9-3-4-11(7-10(9)2)14(16)12-5-6-13(8-12)15(17)18/h3-4,7,12-13H,5-6,8H2,1-2H3,(H,17,18)/t12-,13+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.