CAS 732253-27-9

(1R,3S)-3-(3,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,3S)-3-(3,5-dimethylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-27-9, is a chiral compound characterized by its cyclopentane core structure, which is substituted with a carboxylic acid group and a 3,5-dimethylbenzoyl moiety. This compound exhibits specific stereochemistry, indicated by the (1R,3S) configuration, which influences its reactivity and interaction with biological systems. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. The aromatic 3,5-dimethylbenzoyl group contributes to the compound's hydrophobic characteristics, potentially affecting its solubility and permeability in biological membranes. Additionally, the compound may exhibit unique pharmacological properties due to its structural features, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would typically involve techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm purity and structural integrity.

Formula: C₁₅H₁₈O₃

InChI: InChI=1/C15H18O3/c1-9-5-10(2)7-13(6-9)14(16)11-3-4-12(8-11)15(17)18/h5-7,11-12H,3-4,8H2,1-2H3,(H,17,18)/t11-,12+/m0/s1