CAS 732253-35-9

(1R,2S)-2-(2-methylbenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(2-methylbenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-35-9, is a chiral compound characterized by its specific stereochemistry, indicated by the (1R,2S) configuration. This compound features a cyclopentane ring substituted with a carboxylic acid group and a 2-methylbenzoyl moiety, which contributes to its potential biological activity and applications in pharmaceuticals. The presence of the carboxylic acid functional group suggests it can engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the aromatic 2-methylbenzoyl group may impart unique electronic properties and steric effects, which can affect the compound's interactions with biological targets. The stereochemistry of the compound is crucial for its biological activity, as different enantiomers can exhibit significantly different properties. Overall, this compound's structural features make it of interest in medicinal chemistry and related fields, where it may serve as a lead compound for further development.

Formula: C₁₄H₁₆O₃

InChI: InChI=1/C14H16O3/c1-9-5-2-3-6-10(9)13(15)11-7-4-8-12(11)14(16)17/h2-3,5-6,11-12H,4,7-8H2,1H3,(H,16,17)/t11-,12+/m0/s1