CAS 732253-41-7

(1R,2S)-2-(3-methylbenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,2S)-2-(3-methylbenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which features a carboxylic acid functional group and a 3-methylbenzoyl substituent. The specific stereochemistry indicated by the (1R,2S) notation suggests that the compound has distinct spatial arrangements that can influence its reactivity and interactions with biological systems. This compound is likely to exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can affect its solubility in polar solvents. The presence of the aromatic 3-methylbenzoyl group may contribute to its hydrophobic characteristics and influence its biological activity, making it of interest in pharmaceutical applications. Additionally, the compound's chirality may lead to different biological effects depending on the stereoisomer, which is a crucial consideration in drug design and development. Overall, this compound's unique structure and functional groups suggest potential utility in various chemical and biological contexts.

Formula: C₁₄H₁₆O₃

InChI: InChI=1/C14H16O3/c1-9-4-2-5-10(8-9)13(15)11-6-3-7-12(11)14(16)17/h2,4-5,8,11-12H,3,6-7H2,1H3,(H,16,17)/t11-,12+/m0/s1