CAS 732253-47-3

(1R,2S)-2-(4-methylbenzoyl)cyclopentane-1-carboxylic acid

Description:

(1R,2S)-2-(4-methylbenzoyl)cyclopentane-1-carboxylic acid is a chiral compound characterized by its cyclopentane ring structure, which is substituted at the 1 and 2 positions. The presence of a carboxylic acid functional group at the 1-position contributes to its acidity and reactivity, while the 4-methylbenzoyl group at the 2-position introduces aromatic characteristics and influences its solubility and interaction with other molecules. This compound is likely to exhibit specific stereochemical properties due to its chiral centers, which can affect its biological activity and interactions in various chemical environments. The compound's molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. Its CAS number, 732253-47-3, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, the unique combination of functional groups and stereochemistry makes this compound of interest in both academic and industrial chemistry contexts.

Formula: C₁₄H₁₆O₃

InChI: InChI=1/C14H16O3/c1-9-5-7-10(8-6-9)13(15)11-3-2-4-12(11)14(16)17/h5-8,11-12H,2-4H2,1H3,(H,16,17)/t11-,12+/m0/s1