CAS 732253-54-2

(1R,2S)-2-(2-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(2-methoxybenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-54-2, is characterized by its unique structural features that include a cyclopentane ring substituted with a carboxylic acid and a methoxybenzoyl group. This compound exhibits chirality, as indicated by its (1R,2S) configuration, which can influence its biological activity and interactions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The methoxybenzoyl moiety contributes to its aromatic properties, potentially affecting its reactivity and interactions with other molecules. This compound may be of interest in pharmaceutical applications due to its structural complexity and potential biological activity, making it a candidate for further research in medicinal chemistry. Overall, its unique combination of functional groups and stereochemistry provides a rich area for exploration in both synthetic and applied chemistry contexts.

Formula: C₁₄H₁₆O₄

InChI: InChI=1/C14H16O4/c1-18-12-8-3-2-5-11(12)13(15)9-6-4-7-10(9)14(16)17/h2-3,5,8-10H,4,6-7H2,1H3,(H,16,17)/t9-,10+/m0/s1