CymitQuimica logo

CAS 732253-60-0

:

(1R,2S)-2-(3-methoxybenzoyl)cyclopentane-1-carboxylic acid

Description:
The chemical substance known as (1R,2S)-2-(3-methoxybenzoyl)cyclopentane-1-carboxylic acid, with the CAS number 732253-60-0, is characterized by its unique structural features and functional groups. This compound contains a cyclopentane ring, which is a five-membered carbon ring, and is substituted with a carboxylic acid group and a 3-methoxybenzoyl moiety. The presence of the methoxy group (-OCH3) on the aromatic ring contributes to its solubility and reactivity. The stereochemistry indicated by the (1R,2S) configuration suggests specific spatial arrangements of the substituents, which can influence the compound's biological activity and interactions. This compound may exhibit properties typical of carboxylic acids, such as acidity and the ability to form hydrogen bonds, which can affect its solubility in various solvents. Additionally, the aromatic component may impart unique electronic properties, making it of interest in medicinal chemistry and material science. Overall, the combination of these features makes this compound a subject of interest for further research and potential applications.
Formula:C14H16O4
InChI:InChI=1/C14H16O4/c1-18-10-5-2-4-9(8-10)13(15)11-6-3-7-12(11)14(16)17/h2,4-5,8,11-12H,3,6-7H2,1H3,(H,16,17)/t11-,12+/m0/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.