
CAS 73227-71-1
:2,3,6-Trimethylthieno[2,3-b]pyridin-4-amine
Description:
2,3,6-Trimethylthieno[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its unique structure, which combines a thieno and pyridine ring system. This compound features three methyl groups at the 2, 3, and 6 positions of the thieno ring, contributing to its distinct chemical properties. The presence of an amino group at the 4-position of the pyridine ring enhances its reactivity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions and applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's structure suggests potential biological activity, which can be explored in medicinal chemistry. Its CAS number, 73227-71-1, is a unique identifier that facilitates its identification in chemical databases. Overall, 2,3,6-Trimethylthieno[2,3-b]pyridin-4-amine is of interest in research fields such as pharmaceuticals and organic synthesis due to its structural features and potential applications.
Formula:C10H12N2S
InChI:InChI=1S/C10H12N2S/c1-5-4-8(11)9-6(2)7(3)13-10(9)12-5/h4H,1-3H3,(H2,11,12)
InChI key:InChIKey=DVUJSWDXMGRBTK-UHFFFAOYSA-N
SMILES:CC=1C=2C(SC1C)=NC(C)=CC2N
Synonyms:- 2,3,6-Trimethylthieno[2,3-b]pyridin-4-amine
- Thieno[2,3-b]pyridin-4-amine, 2,3,6-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.