CymitQuimica logo

CAS 73227-84-6

:

2-Cyano-N-(3-cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)acetamide

Description:
2-Cyano-N-(3-cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)acetamide, with the CAS number 73227-84-6, is a chemical compound that features a complex structure characterized by the presence of cyano groups and a tetrahydrobenzo[b]thien moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique functional groups. The cyano groups contribute to its reactivity and may influence its solubility and polarity. The presence of the tetrahydrobenzo[b]thien structure suggests that it may have aromatic characteristics, which can affect its stability and interaction with other molecules. Such compounds are often investigated for their potential applications in pharmaceuticals, agrochemicals, or materials science due to their diverse chemical properties. Additionally, the specific arrangement of atoms and functional groups can lead to interesting electronic properties, making it a subject of interest in various fields of research, including medicinal chemistry and organic synthesis.
Formula:C12H11N3OS
InChI:InChI=1S/C12H11N3OS/c13-6-5-11(16)15-12-9(7-14)8-3-1-2-4-10(8)17-12/h1-5H2,(H,15,16)
InChI key:InChIKey=QXPDESAYGWLKBC-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(SC1NC(CC#N)=O)CCCC2
Synonyms:
  • Acetamide, 2-cyano-N-(3-cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)-
  • 2-Cyano-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide
  • 2-Cyano-N-(3-cyano-4,5,6,7-tetrahydrobenzo[b]thien-2-yl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.