CAS 732291-49-5

4-Acetyl-N-[(2-chlorophenyl)methyl]benzenesulfonamide

Description:

4-Acetyl-N-[(2-chlorophenyl)methyl]benzenesulfonamide, identified by its CAS number 732291-49-5, is a chemical compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. The compound also contains an acetyl group and a chlorophenyl moiety, contributing to its overall structure and potential biological activity. Typically, sulfonamides exhibit antibacterial properties, and modifications in their structure can influence their pharmacological effects. The presence of the acetyl and chlorophenyl groups may enhance lipophilicity and alter the compound's interaction with biological targets. This compound's solubility, stability, and reactivity can vary based on its molecular structure, making it of interest in medicinal chemistry and drug development. As with many sulfonamides, it is essential to consider its safety profile, including potential toxicity and environmental impact, during handling and application in research or therapeutic contexts.

Formula: C₁₅H₁₄ClNO₃S

InChI: InChI=1S/C15H14ClNO3S/c1-11(18)12-6-8-14(9-7-12)21(19,20)17-10-13-4-2-3-5-15(13)16/h2-9,17H,10H2,1H3

InChI key: InChIKey=MFINZOHILQOXPH-UHFFFAOYSA-N

SMILES: S(NCC1=C(Cl)C=CC=C1)(=O)(=O)C2=CC=C(C(C)=O)C=C2

Synonyms:

• 4-Acetyl-N-[(2-chlorophenyl)methyl]benzenesulfonamide
• Benzenesulfonamide, 4-acetyl-N-[(2-chlorophenyl)methyl]-

4-Acetyl-N-[(2-chlorophenyl)methyl]benzene-1-sulfonamide

CAS: 732291-49-5

Versatile small molecule scaffold

Formula: C₁₅H₁₄ClNO₃S

Purity: Min. 95%

Molecular weight: 323.8 g/mol

Ref: 3D-HEB29149