CAS 732291-87-1

2-(2-Bromo-4-formyl-6-methoxyphenoxy)-N,N-dimethylacetamide

Description:

2-(2-Bromo-4-formyl-6-methoxyphenoxy)-N,N-dimethylacetamide is a chemical compound characterized by its complex structure, which includes a brominated aromatic ring, a formyl group, and a methoxy substituent. The presence of the bromine atom enhances its reactivity and potential applications in organic synthesis. The methoxy group contributes to the compound's solubility and may influence its electronic properties. The dimethylacetamide moiety serves as a polar functional group, which can enhance the compound's solubility in various solvents, making it useful in different chemical environments. This compound may exhibit biological activity due to its structural features, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular conformation. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of bromine, which can pose health risks.

Formula: C₁₂H₁₄BrNO₄

InChI: InChI=1S/C12H14BrNO4/c1-14(2)11(16)7-18-12-9(13)4-8(6-15)5-10(12)17-3/h4-6H,7H2,1-3H3

InChI key: InChIKey=KCSLLSVWDHNHGG-UHFFFAOYSA-N

SMILES: O(CC(N(C)C)=O)C1=C(OC)C=C(C=O)C=C1Br

Synonyms:

• Acetamide, 2-(2-bromo-4-formyl-6-methoxyphenoxy)-N,N-dimethyl-
• 2-(2-Bromo-4-formyl-6-methoxyphenoxy)-N,N-dimethylacetamide