CAS 7323-86-6
:6-Ketoestriol
Description:
6-Ketoestriol, with the CAS number 7323-86-6, is a steroid hormone and a metabolite of estriol, which is one of the three main estrogens produced during pregnancy. This compound is characterized by its ketone functional group at the 6-position of the estriol structure, which influences its biological activity and interactions. It is typically found in biological fluids and tissues, where it plays a role in various physiological processes, including the regulation of reproductive functions. 6-Ketoestriol is often studied in the context of hormone replacement therapy and its potential implications in conditions related to estrogen levels. The substance is generally soluble in organic solvents and exhibits a relatively low solubility in water, which is common for steroid compounds. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many steroid hormones, it can bind to estrogen receptors, thereby exerting effects on gene expression and cellular function.
Formula:C18H22O4
InChI:InChI=1S/C18H22O4/c1-18-5-4-11-10-3-2-9(19)6-13(10)15(20)7-12(11)14(18)8-16(21)17(18)22/h2-3,6,11-12,14,16-17,19,21-22H,4-5,7-8H2,1H3/t11-,12-,14+,16-,17+,18+/m1/s1
InChI key:InChIKey=PYFIDTBVOMQKDC-XCYHEEQWSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C=4C(C(=O)C3)=CC(O)=CC4)(CC1)[H])[H])(C[C@@H](O)[C@@H]2O)[H]
Synonyms:- 6-Oxoestriol
- Estra-1,3,5(10)-trien-6-one, 3,16α,17β-trihydroxy-
- 6-Oxo-16α,17β-estriol
- Estra-1,3,5(10)-trien-6-one, 3,16,17-trihydroxy-, (16α,17β)-
- (16α,17β)-3,16,17-Trihydroxyestra-1,3,5(10)-trien-6-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
