CAS 732303-81-0
:L-Glutamic acid, hydrate (1:?)
Description:
L-Glutamic acid, hydrate (CAS 732303-81-0) is a crystalline organic compound that is a derivative of the amino acid glutamic acid, which plays a crucial role in cellular metabolism and neurotransmission. As a hydrate, it contains water molecules in its structure, which can influence its physical properties and stability. This compound is typically characterized by its solubility in water, making it useful in various biochemical applications, including as a flavor enhancer and in nutritional supplements. L-Glutamic acid is known for its role as a neurotransmitter in the brain, where it acts as an excitatory neurotransmitter, facilitating communication between neurons. The presence of the hydrate form may affect its melting point and hygroscopicity. In terms of safety, while L-glutamic acid is generally recognized as safe for consumption, it is important to handle it with care in laboratory settings, following appropriate safety protocols. Overall, L-Glutamic acid, hydrate is significant in both biological systems and industrial applications.
Formula:C5H9NO4·xH2O
InChI:InChI=1S/C5H9NO4.H2O/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H2/t3-;/m0./s1
InChI key:InChIKey=OZDAOHVKBFBBMZ-DFWYDOINSA-N
SMILES:[C@H](CCC(O)=O)(C(O)=O)N.O
Synonyms:- L-Glutamic acid, hydrate
- L-Glutamic acid, hydrate (1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
