
CAS 732304-21-1
:1,2,3-Benzenetricarboxylic acid hydrate
Description:
1,2,3-Benzenetricarboxylic acid hydrate, also known as trimellitic acid hydrate, is an organic compound characterized by its three carboxylic acid functional groups attached to a benzene ring. This compound typically appears as a white crystalline solid and is soluble in water, which is attributed to the presence of the carboxylic acid groups that can form hydrogen bonds with water molecules. The hydrate form indicates that it contains water molecules in its crystal structure, which can influence its physical properties and stability. It is often used in the synthesis of various chemical intermediates, plasticizers, and resins. The presence of multiple carboxylic acid groups allows for the formation of salts and esters, making it versatile in chemical reactions. Additionally, its structure contributes to its potential applications in the fields of materials science and pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H8O7
InChI:InChI=1S/C9H6O6.H2O/c10-7(11)4-2-1-3-5(8(12)13)6(4)9(14)15;/h1-3H,(H,10,11)(H,12,13)(H,14,15);1H2
InChI key:DYDNZUYNRZENMU-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)C(=O)O)C(=O)O)C(=O)O.O
Synonyms:- 1,2,3-Benzenetricarboxylic acid hydrate >=98.0% (calc. based on dry substance, T)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1,2,3-Benzenetricarboxylic acid hydrate
CAS:Formula:C9H8O7Purity:97%Color and Shape:SolidMolecular weight:228.15561,2,3-Benzenetricarboxylic acid hydrate
CAS:1,2,3-Benzenetricarboxylic acid hydrate (BTAH) is a molecule that has been studied as a potential photosensitizer for photodynamic therapy. This compound is an organic semiconductor with a wide absorption spectrum and a large quantum yield in the visible region. It also has high charge carrier mobility, which makes it suitable for use in electronic devices. BTAH is an additive that can be used to inhibit the formation of cancer cells and reduce inflammation. BTAH has been shown to have anti-inflammatory properties by inhibiting prostaglandin synthesis. The molecular structure of BTAH consists of three benzene rings joined together by two carboxyl groups. The central ring in this molecule is also known as 1,2,3-benzenetricarboxylic acid or 3,4-dihydroxybenzoic acid.Formula:C9H6O6·xH2OPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:210.14 g/mol


