CAS 732306-24-0
:4-Chloro-3-(trifluoromethyl)pyridinehydrochloride
Description:
4-Chloro-3-(trifluoromethyl)pyridine hydrochloride is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 4-position and a trifluoromethyl group at the 3-position significantly influences its chemical properties, making it a polar and potentially reactive compound. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. This compound is often utilized in pharmaceutical research and development due to its potential as an intermediate in the synthesis of various biologically active molecules. Its trifluoromethyl group can impart unique electronic properties, making it valuable in medicinal chemistry. Safety data should be consulted, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Proper handling and storage conditions are essential to ensure safety during use.
Formula:C28H21F3O4S
InChI:InChI=1/C27H21O.CHF3O3S/c1-2-10-20(11-3-1)25-23-16-14-18-8-4-6-12-21(18)26(23)28-27-22-13-7-5-9-19(22)15-17-24(25)27;2-1(3,4)8(5,6)7/h1-13H,14-17H2;(H,5,6,7)/q+1;/p-1
Synonyms:- 7-Phenyl-5,6,8,9-tetrahydrodibenzo[c,h]xanthenium trifluoromethanesulfonate
- 7-phenyl-5H,6H,8H,9H-dibenzo[c,h]xanthenium trifluoromethanesulfonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloro-3-(trifluoromethyl)pyridine hydrochloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H4Cl2F3NPurity:97%Color and Shape:Powder or lumps, WhiteMolecular weight:218.004-Chloro-3-(trifluoromethyl)pyridine hydrochloride
CAS:Formula:C6H4Cl2F3NPurity:97%Color and Shape:SolidMolecular weight:218.00394-Chloro-3-(trifluoromethyl)pyridine hydrochloride
CAS:4-Chloro-3-(trifluoromethyl)pyridine hydrochlorideFormula:C6H3ClF3N·ClHPurity:97%Color and Shape: white crystalline solidMolecular weight:218.00g/mol4-Chloro-3-trifluoromethylpyridine hydrochloride
CAS:Formula:C6H4Cl2F3NPurity:97.0%Color and Shape:SolidMolecular weight:218



