CAS 732306-31-9
:2-Amino-3,5-difluoropyridine
Description:
2-Amino-3,5-difluoropyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms and an amino group. The presence of the amino group (-NH2) at the 2-position and fluorine atoms at the 3 and 5 positions contributes to its unique chemical properties, including increased polarity and potential for hydrogen bonding. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is soluble in polar solvents. Its molecular structure allows for various applications in pharmaceuticals and agrochemicals, particularly as a building block in the synthesis of more complex molecules. The fluorine substituents enhance the compound's reactivity and stability, making it of interest in medicinal chemistry for developing new therapeutic agents. Additionally, the compound's properties may include moderate to high melting and boiling points, reflecting the influence of the fluorine atoms on intermolecular interactions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H4F2N2
InChI:InChI=1/C5H4F2N2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9)
SMILES:c1c(cnc(c1F)N)F
Synonyms:- 2-Pyridinamine, 3,5-Difluoro-
- 3,5-Difluoro-2-pyridinamine
- 3,5-Difluoropyridin-2-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-3,5-difluoropyridine, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H4F2N2Purity:98%Color and Shape:Crystals or powder or crystalline powder, White to pale brownMolecular weight:130.102-Amino-3,5-difluoropyridine
CAS:Formula:C5H4F2N2Purity:98%Color and Shape:SolidMolecular weight:130.09552-Amino-3,5-difluoropyridine
CAS:2-Amino-3,5-difluoropyridineFormula:C5H4F2N2Purity:98%Color and Shape:SolidMolecular weight:130.10g/mol2-Amino-3,5-difluoropyridine
CAS:Formula:C5H4F2N2Purity:98%Color and Shape:SolidMolecular weight:130.098



