CymitQuimica logo

CAS 73237-76-0

:

L-Leucine, N-L-leucyl-, monoacetate

Description:
L-Leucine, N-L-leucyl-, monoacetate is a derivative of the essential amino acid L-leucine, which plays a crucial role in protein synthesis and metabolic processes. This compound features an acetyl group attached to the nitrogen of the leucine side chain, which can influence its solubility and biological activity. Characteristically, it is a white to off-white solid that is soluble in polar solvents, such as water and alcohol, due to the presence of the acetyl group. The compound is often studied for its potential applications in pharmaceuticals and biochemistry, particularly in relation to its role in muscle metabolism and as a building block for peptides. Its molecular structure includes a branched-chain aliphatic side group, which is typical of leucine, contributing to its hydrophobic properties. As with many amino acid derivatives, it may exhibit specific biological activities, including promoting muscle protein synthesis and influencing metabolic pathways. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential risks associated with its use.
Formula:C12H24N2O3·C2H4O2
InChI:InChI=1S/C12H24N2O3.C2H4O2/c1-7(2)5-9(13)11(15)14-10(12(16)17)6-8(3)4;1-2(3)4/h7-10H,5-6,13H2,1-4H3,(H,14,15)(H,16,17);1H3,(H,3,4)/t9-,10-;/m0./s1
InChI key:InChIKey=JEUHGRPWUPRNDP-IYPAPVHQSA-N
SMILES:[C@H](NC([C@H](CC(C)C)N)=O)(CC(C)C)C(O)=O.C(C)(O)=O
Synonyms:
  • L-Leucine, N-L-leucyl-, monoacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.